C12H20N2O2 — CID 166528664
ethane;ethyl 5-cyclopropyl-4-methyl-1H-pyrazole-3-carboxylate (PubChem CID 166528664) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is ethane;ethyl 5-cyclopropyl-4-methyl-1H-pyrazole-3-carboxylate.
| Compound Name | ethane;ethyl 5-cyclopropyl-4-methyl-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 166528664 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | ethane;ethyl 5-cyclopropyl-4-methyl-1H-pyrazole-3-carboxylate |
| SMILES | CC.CCOC(=O)c1n[nH]c(C2CC2)c1C |
| InChI | InChI=1S/C10H14N2O2.C2H6/c1-3-14-10(13)9-6(2)8(11-12-9)7-4-5-7;1-2/h7H,3-5H2,1-2H3,(H,11,12);1-2H3 |
| InChIKey | SBWVXFFXYMPVSE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |