C22H27N5O2 — CID 145081262
N-[1-[(4-aminophenyl)methyl]piperidin-4-yl]-N,6-dimethyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-4-carboxamide (PubChem CID 145081262) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-[1-[(4-aminophenyl)methyl]piperidin-4-yl]-N,6-dimethyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-4-carboxamide.
| Compound Name | N-[1-[(4-aminophenyl)methyl]piperidin-4-yl]-N,6-dimethyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 145081262 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N-[1-[(4-aminophenyl)methyl]piperidin-4-yl]-N,6-dimethyl-7-oxo-1H-pyrrolo[2,3-c]pyridine-4-carboxamide |
| SMILES | CN(C(=O)c1cn(C)c(=O)c2[nH]ccc12)C1CCN(Cc2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C22H27N5O2/c1-25-14-19(18-7-10-24-20(18)22(25)29)21(28)26(2)17-8-11-27(12-9-17)13-15-3-5-16(23)6-4-15/h3-7,10,14,17,24H,8-9,11-13,23H2,1-2H3 |
| InChIKey | GQYWSBUMUXBPHR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|