C14H13N3O — CID 121334596
4-(4-aminophenyl)-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one (PubChem CID 121334596) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is 4-(4-aminophenyl)-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 4-(4-aminophenyl)-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 121334596 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 4-(4-aminophenyl)-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | Cn1cc(-c2ccc(N)cc2)c2cc[nH]c2c1=O |
| InChI | InChI=1S/C14H13N3O/c1-17-8-12(9-2-4-10(15)5-3-9)11-6-7-16-13(11)14(17)18/h2-8,16H,15H2,1H3 |
| InChIKey | KYXWJILQVLMYDH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 63.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|