C20H18N4O2 — CID 146323059
4-[5-amino-2-(3-methyl-4-oxo-1-pyridinyl)phenyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one (PubChem CID 146323059) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 4-[5-amino-2-(3-methyl-4-oxo-1-pyridinyl)phenyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 4-[5-amino-2-(3-methyl-4-oxo-1-pyridinyl)phenyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 146323059 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 4-[5-amino-2-(3-methyl-4-oxo-1-pyridinyl)phenyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | Cc1cn(-c2ccc(N)cc2-c2cn(C)c(=O)c3[nH]ccc23)ccc1=O |
| InChI | InChI=1S/C20H18N4O2/c1-12-10-24(8-6-18(12)25)17-4-3-13(21)9-15(17)16-11-23(2)20(26)19-14(16)5-7-22-19/h3-11,22H,21H2,1-2H3 |
| InChIKey | LVGULRSJAIOPFZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|