C10H18N4 — CID 145081293
1-[(Z)-4-iminobut-2-enimidoyl]-N-methylpiperidin-4-amine (PubChem CID 145081293) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-[(Z)-4-iminobut-2-enimidoyl]-N-methylpiperidin-4-amine.
| Compound Name | 1-[(Z)-4-iminobut-2-enimidoyl]-N-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 145081293 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 1-[(Z)-4-iminobut-2-enimidoyl]-N-methylpiperidin-4-amine |
| SMILES | [H]/N=C/C=C\C(=N/[H])N1CCC(NC)CC1 |
| InChI | InChI=1S/C10H18N4/c1-13-9-4-7-14(8-5-9)10(12)3-2-6-11/h2-3,6,9,11-13H,4-5,7-8H2,1H3/b3-2-,11-6+,12-10+ |
| InChIKey | CMEYGSMHLWHUQL-UYQYLYHFSA-N |
| XLogP | 0.85 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|