C17H25N3O2 — CID 145081509
4-[[[(1R)-1-cyclohexylethyl]amino]-hydroxymethyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one (PubChem CID 145081509) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 4-[[[(1R)-1-cyclohexylethyl]amino]-hydroxymethyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 4-[[[(1R)-1-cyclohexylethyl]amino]-hydroxymethyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 145081509 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 4-[[[(1R)-1-cyclohexylethyl]amino]-hydroxymethyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | C[C@@H](NC(O)c1cn(C)c(=O)c2[nH]ccc12)C1CCCCC1 |
| InChI | InChI=1S/C17H25N3O2/c1-11(12-6-4-3-5-7-12)19-16(21)14-10-20(2)17(22)15-13(14)8-9-18-15/h8-12,16,18-19,21H,3-7H2,1-2H3/t11-,16?/m1/s1 |
| InChIKey | QDDQMFDFLADHQY-ZVDHGWRTSA-N |
| XLogP | 2.42 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|