C26H34FN5O3 — CID 145081531
1-[(E)-2-(2,5-dimethyl-1H-pyrrol-3-yl)-3-[formyl(prop-2-enyl)amino]prop-2-enoyl]-4-(4-fluorophenyl)piperazine-2-carboxamide;ethane (PubChem CID 145081531) has the molecular formula C26H34FN5O3 and a molecular weight of 483.59 g/mol. Its IUPAC name is 1-[(E)-2-(2,5-dimethyl-1H-pyrrol-3-yl)-3-[formyl(prop-2-enyl)amino]prop-2-enoyl]-4-(4-fluorophenyl)piperazine-2-carboxamide;ethane.
| Compound Name | 1-[(E)-2-(2,5-dimethyl-1H-pyrrol-3-yl)-3-[formyl(prop-2-enyl)amino]prop-2-enoyl]-4-(4-fluorophenyl)piperazine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 145081531 |
| Molecular Formula | C26H34FN5O3 |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 1-[(E)-2-(2,5-dimethyl-1H-pyrrol-3-yl)-3-[formyl(prop-2-enyl)amino]prop-2-enoyl]-4-(4-fluorophenyl)piperazine-2-carboxamide;ethane |
| SMILES | C=CCN(C=O)/C=C(/C(=O)N1CCN(c2ccc(F)cc2)CC1C(N)=O)c1cc(C)[nH]c1C.CC |
| InChI | InChI=1S/C24H28FN5O3.C2H6/c1-4-9-28(15-31)13-21(20-12-16(2)27-17(20)3)24(33)30-11-10-29(14-22(30)23(26)32)19-7-5-18(25)6-8-19;1-2/h4-8,12-13,15,22,27H,1,9-11,14H2,2-3H3,(H2,26,32);1-2H3/b21-13+; |
| InChIKey | IIFCGKNQJWKCRD-PGCULMPHSA-N |
| XLogP | 2.98 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|