C19H22FN3O2S — CID 177332519
4-[4-(4-fluorophenyl)piperazin-1-yl]-2-methylbenzoic acid;methanethioamide (PubChem CID 177332519) has the molecular formula C19H22FN3O2S and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)piperazin-1-yl]-2-methylbenzoic acid;methanethioamide.
| Compound Name | 4-[4-(4-fluorophenyl)piperazin-1-yl]-2-methylbenzoic acid;methanethioamide |
|---|---|
| PubChem CID | 177332519 |
| Molecular Formula | C19H22FN3O2S |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 4-[4-(4-fluorophenyl)piperazin-1-yl]-2-methylbenzoic acid;methanethioamide |
| SMILES | Cc1cc(N2CCN(c3ccc(F)cc3)CC2)ccc1C(=O)O.NC=S |
| InChI | InChI=1S/C18H19FN2O2.CH3NS/c1-13-12-16(6-7-17(13)18(22)23)21-10-8-20(9-11-21)15-4-2-14(19)3-5-15;2-1-3/h2-7,12H,8-11H2,1H3,(H,22,23);1H,(H2,2,3) |
| InChIKey | OHBMKLCHPPLRGU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|