C18H17F3N2O2 — CID 177332513
fluoro 4-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-methylbenzoate (PubChem CID 177332513) has the molecular formula C18H17F3N2O2 and a molecular weight of 350.34 g/mol. Its IUPAC name is fluoro 4-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-methylbenzoate.
| Compound Name | fluoro 4-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-methylbenzoate |
|---|---|
| PubChem CID | 177332513 |
| Molecular Formula | C18H17F3N2O2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | fluoro 4-[4-(2,4-difluorophenyl)piperazin-1-yl]-2-methylbenzoate |
| SMILES | Cc1cc(N2CCN(c3ccc(F)cc3F)CC2)ccc1C(=O)OF |
| InChI | InChI=1S/C18H17F3N2O2/c1-12-10-14(3-4-15(12)18(24)25-21)22-6-8-23(9-7-22)17-5-2-13(19)11-16(17)20/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | MJMZIGLXFIUIHU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |