C24H18F3N5O2 — CID 145083589
N-(1,3-benzoxazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 145083589) has the molecular formula C24H18F3N5O2 and a molecular weight of 465.44 g/mol. Its IUPAC name is N-(1,3-benzoxazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | N-(1,3-benzoxazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 145083589 |
| Molecular Formula | C24H18F3N5O2 |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | N-(1,3-benzoxazol-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2o1)N1c2nc(-c3cccc(C(F)(F)F)c3)ccc2N2CCC1C2 |
| InChI | InChI=1S/C24H18F3N5O2/c25-24(26,27)15-5-3-4-14(12-15)17-8-9-19-21(28-17)32(16-10-11-31(19)13-16)23(33)30-22-29-18-6-1-2-7-20(18)34-22/h1-9,12,16H,10-11,13H2,(H,29,30,33) |
| InChIKey | DAXUELZAECFAMF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |