C24H26F3N5O4 — CID 145084028
methyl 2-[1-oxo-1-[(9S)-5-(2,2,2-trifluoroethylcarbamoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]pentan-3-yl]pyridine-4-carboxylate (PubChem CID 145084028) has the molecular formula C24H26F3N5O4 and a molecular weight of 505.50 g/mol. Its IUPAC name is methyl 2-[1-oxo-1-[(9S)-5-(2,2,2-trifluoroethylcarbamoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]pentan-3-yl]pyridine-4-carboxylate.
| Compound Name | methyl 2-[1-oxo-1-[(9S)-5-(2,2,2-trifluoroethylcarbamoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]pentan-3-yl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 145084028 |
| Molecular Formula | C24H26F3N5O4 |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | methyl 2-[1-oxo-1-[(9S)-5-(2,2,2-trifluoroethylcarbamoyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]pentan-3-yl]pyridine-4-carboxylate |
| SMILES | CCC(CC(=O)N1c2nc(C(=O)NCC(F)(F)F)ccc2N2CC[C@H]1C2)c1cc(C(=O)OC)ccn1 |
| InChI | InChI=1S/C24H26F3N5O4/c1-3-14(18-10-15(6-8-28-18)23(35)36-2)11-20(33)32-16-7-9-31(12-16)19-5-4-17(30-21(19)32)22(34)29-13-24(25,26)27/h4-6,8,10,14,16H,3,7,9,11-13H2,1-2H3,(H,29,34)/t14?,16-/m0/s1 |
| InChIKey | ALXRYOCNCZUSJA-WMCAAGNKSA-N |
| XLogP | 3.06 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |