About 2-dimethylboranyloxyethanol;2,4-dimethylpentan-2-amine
2-dimethylboranyloxyethanol;2,4-dimethylpentan-2-amine (PubChem CID 145084996) has the molecular formula C11H28BNO2
and a molecular weight of 217.16 g/mol. Its IUPAC name is 2-dimethylboranyloxyethanol;2,4-dimethylpentan-2-amine.
Molecular Properties
| Compound Name | 2-dimethylboranyloxyethanol;2,4-dimethylpentan-2-amine |
| PubChem CID | 145084996 |
| Molecular Formula | C11H28BNO2 |
| Molecular Weight | 217.16 g/mol |
| Exact Mass | 217.22 |
| IUPAC Name | 2-dimethylboranyloxyethanol;2,4-dimethylpentan-2-amine |
| SMILES | CB(C)OCCO.CC(C)CC(C)(C)N |
| InChI | InChI=1S/C7H17N.C4H11BO2/c1-6(2)5-7(3,4)8;1-5(2)7-4-3-6/h6H,5,8H2,1-4H3;6H,3-4H2,1-2H3 |
| InChIKey | UJWHYHMANAPUSO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.16 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-dimethylboranyloxyethanol;2,4-dimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dimethylboranyloxyethanol;2,4-dimethylpentan-2-amine?
The IUPAC name of 2-dimethylboranyloxyethanol;2,4-dimethylpentan-2-amine (CID 145084996) is 2-dimethylboranyloxyethanol;2,4-dimethylpentan-2-amine.
What is the SMILES notation for 2-dimethylboranyloxyethanol;2,4-dimethylpentan-2-amine?
The canonical SMILES for 2-dimethylboranyloxyethanol;2,4-dimethylpentan-2-amine is CB(C)OCCO.CC(C)CC(C)(C)N.
What is the InChIKey of 2-dimethylboranyloxyethanol;2,4-dimethylpentan-2-amine?
The InChIKey is UJWHYHMANAPUSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N.C4H11BO2/c1-6(2)5-7(3,4)8;1-5(2)7-4-3-6/h6H,5,8H2,1-4H3;6H,3-4H2,1-2H3.
What are the key properties of 2-dimethylboranyloxyethanol;2,4-dimethylpentan-2-amine?
2-dimethylboranyloxyethanol;2,4-dimethylpentan-2-amine has a molecular weight of 217.16 g/mol, XLogP of 2.02, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dimethylboranyloxyethanol;2,4-dimethylpentan-2-amine is sourced from PubChem (CID 145084996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).