C14H22O5 — CID 126732371
2-hydroxyethyl 5-(2-methoxy-4-methylpentan-2-yl)furan-2-carboxylate (PubChem CID 126732371) has the molecular formula C14H22O5 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-hydroxyethyl 5-(2-methoxy-4-methylpentan-2-yl)furan-2-carboxylate.
| Compound Name | 2-hydroxyethyl 5-(2-methoxy-4-methylpentan-2-yl)furan-2-carboxylate |
|---|---|
| PubChem CID | 126732371 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-hydroxyethyl 5-(2-methoxy-4-methylpentan-2-yl)furan-2-carboxylate |
| SMILES | COC(C)(CC(C)C)c1ccc(C(=O)OCCO)o1 |
| InChI | InChI=1S/C14H22O5/c1-10(2)9-14(3,17-4)12-6-5-11(19-12)13(16)18-8-7-15/h5-6,10,15H,7-9H2,1-4H3 |
| InChIKey | KDUXQGGSWQZRRK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |