C22H23N — CID 145085094
19,19-dimethyl-3-azapentacyclo[10.7.0.02,9.04,8.013,18]nonadeca-1(12),2(9),4(8),5,10,13,15,17-octaene;ethane (PubChem CID 145085094) has the molecular formula C22H23N and a molecular weight of 301.43 g/mol. Its IUPAC name is 19,19-dimethyl-3-azapentacyclo[10.7.0.02,9.04,8.013,18]nonadeca-1(12),2(9),4(8),5,10,13,15,17-octaene;ethane.
| Compound Name | 19,19-dimethyl-3-azapentacyclo[10.7.0.02,9.04,8.013,18]nonadeca-1(12),2(9),4(8),5,10,13,15,17-octaene;ethane |
|---|---|
| PubChem CID | 145085094 |
| Molecular Formula | C22H23N |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 19,19-dimethyl-3-azapentacyclo[10.7.0.02,9.04,8.013,18]nonadeca-1(12),2(9),4(8),5,10,13,15,17-octaene;ethane |
| SMILES | CC.CC1(C)c2ccccc2-c2ccc3c4c([nH]c3c21)C=CC4 |
| InChI | InChI=1S/C20H17N.C2H6/c1-20(2)16-8-4-3-6-12(16)14-10-11-15-13-7-5-9-17(13)21-19(15)18(14)20;1-2/h3-6,8-11,21H,7H2,1-2H3;1-2H3 |
| InChIKey | SUWKHNGRLXYXLO-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |