C24H21FN4O3S — CID 145085677
1-[[5-[5-[1-[(4-fluorophenyl)methyl]indol-5-yl]furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]propane-2,2-diol (PubChem CID 145085677) has the molecular formula C24H21FN4O3S and a molecular weight of 464.52 g/mol. Its IUPAC name is 1-[[5-[5-[1-[(4-fluorophenyl)methyl]indol-5-yl]furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]propane-2,2-diol.
| Compound Name | 1-[[5-[5-[1-[(4-fluorophenyl)methyl]indol-5-yl]furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]propane-2,2-diol |
|---|---|
| PubChem CID | 145085677 |
| Molecular Formula | C24H21FN4O3S |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 1-[[5-[5-[1-[(4-fluorophenyl)methyl]indol-5-yl]furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]propane-2,2-diol |
| SMILES | CC(O)(O)CSc1n[nH]c(-c2ccc(-c3ccc4c(ccn4Cc4ccc(F)cc4)c3)o2)n1 |
| InChI | InChI=1S/C24H21FN4O3S/c1-24(30,31)14-33-23-26-22(27-28-23)21-9-8-20(32-21)17-4-7-19-16(12-17)10-11-29(19)13-15-2-5-18(25)6-3-15/h2-12,30-31H,13-14H2,1H3,(H,26,27,28) |
| InChIKey | CWAIBPBJOAQAJN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|