C15H12ClN3O2 — CID 145086481
N-[3,4-bis(methylideneamino)phenyl]-5-chloro-2-hydroxybenzamide (PubChem CID 145086481) has the molecular formula C15H12ClN3O2 and a molecular weight of 301.73 g/mol. Its IUPAC name is N-[3,4-bis(methylideneamino)phenyl]-5-chloro-2-hydroxybenzamide.
| Compound Name | N-[3,4-bis(methylideneamino)phenyl]-5-chloro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 145086481 |
| Molecular Formula | C15H12ClN3O2 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | N-[3,4-bis(methylideneamino)phenyl]-5-chloro-2-hydroxybenzamide |
| SMILES | C=Nc1ccc(NC(=O)c2cc(Cl)ccc2O)cc1N=C |
| InChI | InChI=1S/C15H12ClN3O2/c1-17-12-5-4-10(8-13(12)18-2)19-15(21)11-7-9(16)3-6-14(11)20/h3-8,20H,1-2H2,(H,19,21) |
| InChIKey | XPVOSXPPXVCVND-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|