C26H31N7O2 — CID 145087074
N-[(1S,2R)-2-(methoxymethoxy)cyclohexyl]-5-(1-methylpyrazol-4-yl)-2-[3-(1-methylpyrazol-4-yl)phenyl]pyrimidin-4-amine (PubChem CID 145087074) has the molecular formula C26H31N7O2 and a molecular weight of 473.58 g/mol. Its IUPAC name is N-[(1S,2R)-2-(methoxymethoxy)cyclohexyl]-5-(1-methylpyrazol-4-yl)-2-[3-(1-methylpyrazol-4-yl)phenyl]pyrimidin-4-amine.
| Compound Name | N-[(1S,2R)-2-(methoxymethoxy)cyclohexyl]-5-(1-methylpyrazol-4-yl)-2-[3-(1-methylpyrazol-4-yl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 145087074 |
| Molecular Formula | C26H31N7O2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | N-[(1S,2R)-2-(methoxymethoxy)cyclohexyl]-5-(1-methylpyrazol-4-yl)-2-[3-(1-methylpyrazol-4-yl)phenyl]pyrimidin-4-amine |
| SMILES | COCO[C@@H]1CCCC[C@@H]1Nc1nc(-c2cccc(-c3cnn(C)c3)c2)ncc1-c1cnn(C)c1 |
| InChI | InChI=1S/C26H31N7O2/c1-32-15-20(12-28-32)18-7-6-8-19(11-18)25-27-14-22(21-13-29-33(2)16-21)26(31-25)30-23-9-4-5-10-24(23)35-17-34-3/h6-8,11-16,23-24H,4-5,9-10,17H2,1-3H3,(H,27,30,31)/t23-,24+/m0/s1 |
| InChIKey | PHPRVJQGXACZDU-BJKOFHAPSA-N |
| XLogP | 4.29 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|