C25H29N7O — CID 163507262
2-[3-(1-amino-3-methyliminoprop-1-en-2-yl)phenyl]-5-(1-methylpyrazol-4-yl)-N-(8-oxabicyclo[5.1.0]octan-2-yl)pyrimidin-4-amine (PubChem CID 163507262) has the molecular formula C25H29N7O and a molecular weight of 443.56 g/mol. Its IUPAC name is 2-[3-(1-amino-3-methyliminoprop-1-en-2-yl)phenyl]-5-(1-methylpyrazol-4-yl)-N-(8-oxabicyclo[5.1.0]octan-2-yl)pyrimidin-4-amine.
| Compound Name | 2-[3-(1-amino-3-methyliminoprop-1-en-2-yl)phenyl]-5-(1-methylpyrazol-4-yl)-N-(8-oxabicyclo[5.1.0]octan-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 163507262 |
| Molecular Formula | C25H29N7O |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 2-[3-(1-amino-3-methyliminoprop-1-en-2-yl)phenyl]-5-(1-methylpyrazol-4-yl)-N-(8-oxabicyclo[5.1.0]octan-2-yl)pyrimidin-4-amine |
| SMILES | C/N=C/C(=CN)c1cccc(-c2ncc(-c3cnn(C)c3)c(NC3CCCCC4OC34)n2)c1 |
| InChI | InChI=1S/C25H29N7O/c1-27-12-18(11-26)16-6-5-7-17(10-16)24-28-14-20(19-13-29-32(2)15-19)25(31-24)30-21-8-3-4-9-22-23(21)33-22/h5-7,10-15,21-23H,3-4,8-9,26H2,1-2H3,(H,28,30,31)/b18-11?,27-12+ |
| InChIKey | URUDUEQSIZZHOM-CZIZZHSZSA-N |
| XLogP | 3.67 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|