C21H19F3N8O — CID 145087315
(9S)-9-ethyl-N-pyrazin-2-yl-5-[2-(trifluoromethyl)pyrimidin-4-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 145087315) has the molecular formula C21H19F3N8O and a molecular weight of 456.43 g/mol. Its IUPAC name is (9S)-9-ethyl-N-pyrazin-2-yl-5-[2-(trifluoromethyl)pyrimidin-4-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-9-ethyl-N-pyrazin-2-yl-5-[2-(trifluoromethyl)pyrimidin-4-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 145087315 |
| Molecular Formula | C21H19F3N8O |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | (9S)-9-ethyl-N-pyrazin-2-yl-5-[2-(trifluoromethyl)pyrimidin-4-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CC[C@]12CCN(C1)c1ccc(-c3ccnc(C(F)(F)F)n3)nc1N2C(=O)Nc1cnccn1 |
| InChI | InChI=1S/C21H19F3N8O/c1-2-20-6-10-31(12-20)15-4-3-13(14-5-7-27-18(29-14)21(22,23)24)28-17(15)32(20)19(33)30-16-11-25-8-9-26-16/h3-5,7-9,11H,2,6,10,12H2,1H3,(H,26,30,33)/t20-/m0/s1 |
| InChIKey | PJYCJKWXXWSEEU-FQEVSTJZSA-N |
| XLogP | 3.76 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |