C12H24N4O2 — CID 145088372
N-(1-amino-3-oxobutan-2-yl)-2-[[(3R)-piperidin-3-yl]methylamino]acetamide (PubChem CID 145088372) has the molecular formula C12H24N4O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is N-(1-amino-3-oxobutan-2-yl)-2-[[(3R)-piperidin-3-yl]methylamino]acetamide.
| Compound Name | N-(1-amino-3-oxobutan-2-yl)-2-[[(3R)-piperidin-3-yl]methylamino]acetamide |
|---|---|
| PubChem CID | 145088372 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | N-(1-amino-3-oxobutan-2-yl)-2-[[(3R)-piperidin-3-yl]methylamino]acetamide |
| SMILES | CC(=O)C(CN)NC(=O)CNC[C@@H]1CCCNC1 |
| InChI | InChI=1S/C12H24N4O2/c1-9(17)11(5-13)16-12(18)8-15-7-10-3-2-4-14-6-10/h10-11,14-15H,2-8,13H2,1H3,(H,16,18)/t10-,11?/m1/s1 |
| InChIKey | FHWMNFCKEFJJIB-NFJWQWPMSA-N |
| XLogP | -1.39 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |