C34H20N8O — CID 145088630
3-(benzimidazol-1-yl)-8-dibenzofuran-2-yl-14-phenyl-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaene (PubChem CID 145088630) has the molecular formula C34H20N8O and a molecular weight of 556.59 g/mol. Its IUPAC name is 3-(benzimidazol-1-yl)-8-dibenzofuran-2-yl-14-phenyl-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaene.
| Compound Name | 3-(benzimidazol-1-yl)-8-dibenzofuran-2-yl-14-phenyl-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaene |
|---|---|
| PubChem CID | 145088630 |
| Molecular Formula | C34H20N8O |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | 3-(benzimidazol-1-yl)-8-dibenzofuran-2-yl-14-phenyl-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaene |
| SMILES | c1ccc(-c2cc3n4ncc(-c5ccc6oc7ccccc7c6c5)c4n4ncc(-n5cnc6ccccc65)c4n3n2)cc1 |
| InChI | InChI=1S/C34H20N8O/c1-2-8-21(9-3-1)27-17-32-40-33(25(18-36-40)22-14-15-31-24(16-22)23-10-4-7-13-30(23)43-31)42-34(41(32)38-27)29(19-37-42)39-20-35-26-11-5-6-12-28(26)39/h1-20H |
| InChIKey | LZGSHNSCKFLAKO-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 82.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |