C13H12BrF4NO2 — CID 145089084
N-[3-(5-bromo-2-fluorophenyl)oxan-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 145089084) has the molecular formula C13H12BrF4NO2 and a molecular weight of 370.14 g/mol. Its IUPAC name is N-[3-(5-bromo-2-fluorophenyl)oxan-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-(5-bromo-2-fluorophenyl)oxan-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 145089084 |
| Molecular Formula | C13H12BrF4NO2 |
| Molecular Weight | 370.14 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | N-[3-(5-bromo-2-fluorophenyl)oxan-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NC1(c2cc(Br)ccc2F)CCCOC1)C(F)(F)F |
| InChI | InChI=1S/C13H12BrF4NO2/c14-8-2-3-10(15)9(6-8)12(4-1-5-21-7-12)19-11(20)13(16,17)18/h2-3,6H,1,4-5,7H2,(H,19,20) |
| InChIKey | IDYAXRJIPNVYSF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.14 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |