C8H12F3NO2 — CID 103899257
2,2,2-trifluoro-N-(3-methyloxan-3-yl)acetamide (PubChem CID 103899257) has the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(3-methyloxan-3-yl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(3-methyloxan-3-yl)acetamide |
|---|---|
| PubChem CID | 103899257 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2,2,2-trifluoro-N-(3-methyloxan-3-yl)acetamide |
| SMILES | CC1(NC(=O)C(F)(F)F)CCCOC1 |
| InChI | InChI=1S/C8H12F3NO2/c1-7(3-2-4-14-5-7)12-6(13)8(9,10)11/h2-5H2,1H3,(H,12,13) |
| InChIKey | YSUNGOSGPCCDOS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |