C25H45NOS2 — CID 145089923
10,13-dimethyl-17-[2-methyl-2-(methylaminosulfanylmethylsulfanyl)propyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-12-ol (PubChem CID 145089923) has the molecular formula C25H45NOS2 and a molecular weight of 439.78 g/mol. Its IUPAC name is 10,13-dimethyl-17-[2-methyl-2-(methylaminosulfanylmethylsulfanyl)propyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-12-ol.
| Compound Name | 10,13-dimethyl-17-[2-methyl-2-(methylaminosulfanylmethylsulfanyl)propyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-12-ol |
|---|---|
| PubChem CID | 145089923 |
| Molecular Formula | C25H45NOS2 |
| Molecular Weight | 439.78 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | 10,13-dimethyl-17-[2-methyl-2-(methylaminosulfanylmethylsulfanyl)propyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-12-ol |
| SMILES | CNSCSC(C)(C)CC1CCC2C3CCC4CCCCC4(C)C3CC(O)C12C |
| InChI | InChI=1S/C25H45NOS2/c1-23(2,28-16-29-26-5)15-18-10-12-20-19-11-9-17-8-6-7-13-24(17,3)21(19)14-22(27)25(18,20)4/h17-22,26-27H,6-16H2,1-5H3 |
| InChIKey | NMUVRTXAGYFXFD-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.78 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|