C26H46N2OS — CID 145089869
N-[1-[1-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylpropan-2-yl]sulfanylethylamino]formamide (PubChem CID 145089869) has the molecular formula C26H46N2OS and a molecular weight of 434.73 g/mol. Its IUPAC name is N-[1-[1-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylpropan-2-yl]sulfanylethylamino]formamide.
| Compound Name | N-[1-[1-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylpropan-2-yl]sulfanylethylamino]formamide |
|---|---|
| PubChem CID | 145089869 |
| Molecular Formula | C26H46N2OS |
| Molecular Weight | 434.73 g/mol |
| Exact Mass | 434.33 |
| IUPAC Name | N-[1-[1-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylpropan-2-yl]sulfanylethylamino]formamide |
| SMILES | CC(NNC=O)SC(C)(C)CC1CCC2C3CCC4CCCCC4(C)C3CCC12C |
| InChI | InChI=1S/C26H46N2OS/c1-18(28-27-17-29)30-24(2,3)16-20-10-12-22-21-11-9-19-8-6-7-14-25(19,4)23(21)13-15-26(20,22)5/h17-23,28H,6-16H2,1-5H3,(H,27,29) |
| InChIKey | SCGYBUNLBDUEJW-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.73 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|