C22H37NO — CID 57077500
N-[1-[(8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]formamide (PubChem CID 57077500) has the molecular formula C22H37NO and a molecular weight of 331.54 g/mol. Its IUPAC name is N-[1-[(8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]formamide.
| Compound Name | N-[1-[(8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]formamide |
|---|---|
| PubChem CID | 57077500 |
| Molecular Formula | C22H37NO |
| Molecular Weight | 331.54 g/mol |
| Exact Mass | 331.29 |
| IUPAC Name | N-[1-[(8R,9S,10S,13S,14S,17S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]formamide |
| SMILES | CC(NC=O)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H37NO/c1-15(23-14-24)18-9-10-19-17-8-7-16-6-4-5-12-21(16,2)20(17)11-13-22(18,19)3/h14-20H,4-13H2,1-3H3,(H,23,24)/t15?,16?,17-,18+,19-,20-,21-,22+/m0/s1 |
| InChIKey | GGMKHQUYAUQPFH-QSZBOJPKSA-N |
| XLogP | 5.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|