C24H40O — CID 141477718
(4R)-1,2,2,3-tetradeuterio-4-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one (PubChem CID 141477718) has the molecular formula C24H40O and a molecular weight of 348.61 g/mol. Its IUPAC name is (4R)-1,2,2,3-tetradeuterio-4-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one.
| Compound Name | (4R)-1,2,2,3-tetradeuterio-4-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one |
|---|---|
| PubChem CID | 141477718 |
| Molecular Formula | C24H40O |
| Molecular Weight | 348.61 g/mol |
| Exact Mass | 348.33 |
| IUPAC Name | (4R)-1,2,2,3-tetradeuterio-4-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentan-1-one |
| SMILES | [2H]C(=O)C([2H])([2H])C([2H])[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H40O/c1-17(7-6-16-25)20-11-12-21-19-10-9-18-8-4-5-14-23(18,2)22(19)13-15-24(20,21)3/h16-22H,4-15H2,1-3H3/t17-,18?,19+,20-,21+,22+,23+,24-/m1/s1/i6D2,7D,16D/t7?,17-,18?,19+,20-,21+,22+,23+,24- |
| InChIKey | FGJWOWMUTIGRTH-FIMXDHKHSA-N |
| XLogP | 6.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.61 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|