C29H53NO5S — CID 145092533
(4R)-4-[(1S,5R,8R,9R,10S)-8-ethyl-5,9-dihydroxy-2,11-dimethyl-14-tricyclo[8.7.0.02,7]heptadecanyl]-N-propan-2-ylsulfonylpentanamide (PubChem CID 145092533) has the molecular formula C29H53NO5S and a molecular weight of 527.81 g/mol. Its IUPAC name is (4R)-4-[(1S,5R,8R,9R,10S)-8-ethyl-5,9-dihydroxy-2,11-dimethyl-14-tricyclo[8.7.0.02,7]heptadecanyl]-N-propan-2-ylsulfonylpentanamide.
| Compound Name | (4R)-4-[(1S,5R,8R,9R,10S)-8-ethyl-5,9-dihydroxy-2,11-dimethyl-14-tricyclo[8.7.0.02,7]heptadecanyl]-N-propan-2-ylsulfonylpentanamide |
|---|---|
| PubChem CID | 145092533 |
| Molecular Formula | C29H53NO5S |
| Molecular Weight | 527.81 g/mol |
| Exact Mass | 527.36 |
| IUPAC Name | (4R)-4-[(1S,5R,8R,9R,10S)-8-ethyl-5,9-dihydroxy-2,11-dimethyl-14-tricyclo[8.7.0.02,7]heptadecanyl]-N-propan-2-ylsulfonylpentanamide |
| SMILES | CC[C@@H]1C2C[C@H](O)CCC2(C)[C@H]2CCCC([C@H](C)CCC(=O)NS(=O)(=O)C(C)C)CCC(C)[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C29H53NO5S/c1-7-23-25-17-22(31)15-16-29(25,6)24-10-8-9-21(13-11-20(5)27(24)28(23)33)19(4)12-14-26(32)30-36(34,35)18(2)3/h18-25,27-28,31,33H,7-17H2,1-6H3,(H,30,32)/t19-,20?,21?,22-,23-,24+,25?,27+,28-,29?/m1/s1 |
| InChIKey | INOQNQJGRPSFMD-JLQSPXPJSA-N |
| XLogP | 5.27 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.81 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |