C26H46O4 — CID 130380273
(4R)-4-[(1S,5R,8R,9R,10S,11S)-8-ethyl-5,9-dihydroxy-2,11-dimethyl-14-tricyclo[8.7.0.02,7]heptadecanyl]pentanoic acid (PubChem CID 130380273) has the molecular formula C26H46O4 and a molecular weight of 422.65 g/mol. Its IUPAC name is (4R)-4-[(1S,5R,8R,9R,10S,11S)-8-ethyl-5,9-dihydroxy-2,11-dimethyl-14-tricyclo[8.7.0.02,7]heptadecanyl]pentanoic acid.
| Compound Name | (4R)-4-[(1S,5R,8R,9R,10S,11S)-8-ethyl-5,9-dihydroxy-2,11-dimethyl-14-tricyclo[8.7.0.02,7]heptadecanyl]pentanoic acid |
|---|---|
| PubChem CID | 130380273 |
| Molecular Formula | C26H46O4 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.34 |
| IUPAC Name | (4R)-4-[(1S,5R,8R,9R,10S,11S)-8-ethyl-5,9-dihydroxy-2,11-dimethyl-14-tricyclo[8.7.0.02,7]heptadecanyl]pentanoic acid |
| SMILES | CC[C@@H]1C2C[C@H](O)CCC2(C)[C@H]2CCCC([C@H](C)CCC(=O)O)CC[C@H](C)[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C26H46O4/c1-5-20-22-15-19(27)13-14-26(22,4)21-8-6-7-18(16(2)10-12-23(28)29)11-9-17(3)24(21)25(20)30/h16-22,24-25,27,30H,5-15H2,1-4H3,(H,28,29)/t16-,17+,18?,19-,20-,21+,22?,24+,25-,26?/m1/s1 |
| InChIKey | HEWPQVPNVBJWCC-KYPZVAOHSA-N |
| XLogP | 5.50 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |