C15H25NO8 — CID 145092720
4-[[3-methyl-4-oxo-4-(1-propan-2-yloxycarbonyloxyethoxy)butyl]amino]-4-oxobutanoic acid (PubChem CID 145092720) has the molecular formula C15H25NO8 and a molecular weight of 347.36 g/mol. Its IUPAC name is 4-[[3-methyl-4-oxo-4-(1-propan-2-yloxycarbonyloxyethoxy)butyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[3-methyl-4-oxo-4-(1-propan-2-yloxycarbonyloxyethoxy)butyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 145092720 |
| Molecular Formula | C15H25NO8 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 4-[[3-methyl-4-oxo-4-(1-propan-2-yloxycarbonyloxyethoxy)butyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)OC(=O)OC(C)OC(=O)C(C)CCNC(=O)CCC(=O)O |
| InChI | InChI=1S/C15H25NO8/c1-9(2)22-15(21)24-11(4)23-14(20)10(3)7-8-16-12(17)5-6-13(18)19/h9-11H,5-8H2,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | NLEBJMVEIRTLNW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|