C38H37BO2 — CID 145092830
2-[10'-ethenyl-9'-[(Z)-prop-1-enyl]spiro[fluorene-9,8'-tricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,9,12-hexaene]-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 145092830) has the molecular formula C38H37BO2 and a molecular weight of 536.52 g/mol. Its IUPAC name is 2-[10'-ethenyl-9'-[(Z)-prop-1-enyl]spiro[fluorene-9,8'-tricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,9,12-hexaene]-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[10'-ethenyl-9'-[(Z)-prop-1-enyl]spiro[fluorene-9,8'-tricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,9,12-hexaene]-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 145092830 |
| Molecular Formula | C38H37BO2 |
| Molecular Weight | 536.52 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | 2-[10'-ethenyl-9'-[(Z)-prop-1-enyl]spiro[fluorene-9,8'-tricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,9,12-hexaene]-4-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=CC1=C(/C=C\C)C2(c3ccccc3C3=C1C=CCC3)c1ccccc1-c1c(B3OC(C)(C)C(C)(C)O3)cccc12 |
| InChI | InChI=1S/C38H37BO2/c1-7-16-30-25(8-2)26-17-9-10-18-27(26)28-19-11-13-21-31(28)38(30)32-22-14-12-20-29(32)35-33(38)23-15-24-34(35)39-40-36(3,4)37(5,6)41-39/h7-9,11-17,19-24H,2,10,18H2,1,3-6H3/b16-7- |
| InChIKey | BLRYPGGUMDXHMM-APSNUPSMSA-N |
| XLogP | 8.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.52 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|