C9H12F3NO — CID 145094891
3-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.1]heptane-6-carbaldehyde (PubChem CID 145094891) has the molecular formula C9H12F3NO and a molecular weight of 207.19 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.1]heptane-6-carbaldehyde.
| Compound Name | 3-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.1]heptane-6-carbaldehyde |
|---|---|
| PubChem CID | 145094891 |
| Molecular Formula | C9H12F3NO |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 3-(2,2,2-trifluoroethyl)-3-azabicyclo[3.1.1]heptane-6-carbaldehyde |
| SMILES | O=CC1C2CC1CN(CC(F)(F)F)C2 |
| InChI | InChI=1S/C9H12F3NO/c10-9(11,12)5-13-2-6-1-7(3-13)8(6)4-14/h4,6-8H,1-3,5H2 |
| InChIKey | IQYUCHNCOLYUFY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|