C9H15F2NO — CID 84663160
2-[1-(2,2-difluoroethyl)piperidin-3-yl]acetaldehyde (PubChem CID 84663160) has the molecular formula C9H15F2NO and a molecular weight of 191.22 g/mol. Its IUPAC name is 2-[1-(2,2-difluoroethyl)piperidin-3-yl]acetaldehyde.
| Compound Name | 2-[1-(2,2-difluoroethyl)piperidin-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 84663160 |
| Molecular Formula | C9H15F2NO |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-[1-(2,2-difluoroethyl)piperidin-3-yl]acetaldehyde |
| SMILES | O=CCC1CCCN(CC(F)F)C1 |
| InChI | InChI=1S/C9H15F2NO/c10-9(11)7-12-4-1-2-8(6-12)3-5-13/h5,8-9H,1-4,6-7H2 |
| InChIKey | JPLLVLOSEYTLQL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|