C14H23N — CID 145094985
methane;9-methyl-1,2,3,4,5,6,7,8-octahydrocarbazole (PubChem CID 145094985) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is methane;9-methyl-1,2,3,4,5,6,7,8-octahydrocarbazole.
| Compound Name | methane;9-methyl-1,2,3,4,5,6,7,8-octahydrocarbazole |
|---|---|
| PubChem CID | 145094985 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | methane;9-methyl-1,2,3,4,5,6,7,8-octahydrocarbazole |
| SMILES | C.Cn1c2c(c3c1CCCC3)CCCC2 |
| InChI | InChI=1S/C13H19N.CH4/c1-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)14;/h2-9H2,1H3;1H4 |
| InChIKey | JSTJEASUDGQGHW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |