C16H16ClNO4S — CID 145096613
methyl 3-(5-chloro-1,3-thiazol-2-yl)-5-(oxolan-3-ylmethoxy)benzoate (PubChem CID 145096613) has the molecular formula C16H16ClNO4S and a molecular weight of 353.83 g/mol. Its IUPAC name is methyl 3-(5-chloro-1,3-thiazol-2-yl)-5-(oxolan-3-ylmethoxy)benzoate.
| Compound Name | methyl 3-(5-chloro-1,3-thiazol-2-yl)-5-(oxolan-3-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 145096613 |
| Molecular Formula | C16H16ClNO4S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | methyl 3-(5-chloro-1,3-thiazol-2-yl)-5-(oxolan-3-ylmethoxy)benzoate |
| SMILES | COC(=O)c1cc(OCC2CCOC2)cc(-c2ncc(Cl)s2)c1 |
| InChI | InChI=1S/C16H16ClNO4S/c1-20-16(19)12-4-11(15-18-7-14(17)23-15)5-13(6-12)22-9-10-2-3-21-8-10/h4-7,10H,2-3,8-9H2,1H3 |
| InChIKey | WRSDJZJOMJLJGI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |