C22H27N3 — CID 145096758
3-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-5-(5-methylcyclohepta-1,3,6-trien-1-yl)-4-propan-2-yl-1,2,4-triazole (PubChem CID 145096758) has the molecular formula C22H27N3 and a molecular weight of 333.48 g/mol. Its IUPAC name is 3-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-5-(5-methylcyclohepta-1,3,6-trien-1-yl)-4-propan-2-yl-1,2,4-triazole.
| Compound Name | 3-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-5-(5-methylcyclohepta-1,3,6-trien-1-yl)-4-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 145096758 |
| Molecular Formula | C22H27N3 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 3-(5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-5-(5-methylcyclohepta-1,3,6-trien-1-yl)-4-propan-2-yl-1,2,4-triazole |
| SMILES | CC1C=CC=C(c2nnc(C3=CC=CC(C)(C)C=C3)n2C(C)C)C=C1 |
| InChI | InChI=1S/C22H27N3/c1-16(2)25-20(18-9-6-8-17(3)11-12-18)23-24-21(25)19-10-7-14-22(4,5)15-13-19/h6-17H,1-5H3 |
| InChIKey | IBJUFEOWHNVWMN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |