C21H26O2 — CID 145096875
[(1E,4E,7Z)-6-methoxy-6-methylcycloocta-1,4,7-trien-1-yl]-(4,5,5-trimethylcyclohepta-1,3,6-trien-1-yl)methanone (PubChem CID 145096875) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is [(1E,4E,7Z)-6-methoxy-6-methylcycloocta-1,4,7-trien-1-yl]-(4,5,5-trimethylcyclohepta-1,3,6-trien-1-yl)methanone.
| Compound Name | [(1E,4E,7Z)-6-methoxy-6-methylcycloocta-1,4,7-trien-1-yl]-(4,5,5-trimethylcyclohepta-1,3,6-trien-1-yl)methanone |
|---|---|
| PubChem CID | 145096875 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | [(1E,4E,7Z)-6-methoxy-6-methylcycloocta-1,4,7-trien-1-yl]-(4,5,5-trimethylcyclohepta-1,3,6-trien-1-yl)methanone |
| SMILES | COC1(C)/C=C\C/C=C(C(=O)C2=CC=C(C)C(C)(C)C=C2)\C=C/1 |
| InChI | InChI=1S/C21H26O2/c1-16-9-10-18(11-14-20(16,2)3)19(22)17-8-6-7-13-21(4,23-5)15-12-17/h7-15H,6H2,1-5H3/b13-7-,15-12-,17-8+ |
| InChIKey | FIOANXBTSIWSLL-CLPSUORLSA-N |
| XLogP | 4.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|