C16H28O2 — CID 142995037
ethane;(3Z,5Z)-3-ethenyl-4-methoxy-8,8-dimethylnona-3,5-dien-2-one (PubChem CID 142995037) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is ethane;(3Z,5Z)-3-ethenyl-4-methoxy-8,8-dimethylnona-3,5-dien-2-one.
| Compound Name | ethane;(3Z,5Z)-3-ethenyl-4-methoxy-8,8-dimethylnona-3,5-dien-2-one |
|---|---|
| PubChem CID | 142995037 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | ethane;(3Z,5Z)-3-ethenyl-4-methoxy-8,8-dimethylnona-3,5-dien-2-one |
| SMILES | C=C/C(C(C)=O)=C(\C=C/CC(C)(C)C)OC.CC |
| InChI | InChI=1S/C14H22O2.C2H6/c1-7-12(11(2)15)13(16-6)9-8-10-14(3,4)5;1-2/h7-9H,1,10H2,2-6H3;1-2H3/b9-8-,13-12-; |
| InChIKey | SKDOFAUWFJRZGG-LEGOAEAWSA-N |
| XLogP | 4.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|