C31H55NO — CID 145097857
molecular hydrogen;(1R,4R,5R,10S,13R,19R)-N,4,5,9,9,13,20,20-octamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-amine (PubChem CID 145097857) has the molecular formula C31H55NO and a molecular weight of 457.79 g/mol. Its IUPAC name is molecular hydrogen;(1R,4R,5R,10S,13R,19R)-N,4,5,9,9,13,20,20-octamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-amine.
| Compound Name | molecular hydrogen;(1R,4R,5R,10S,13R,19R)-N,4,5,9,9,13,20,20-octamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-amine |
|---|---|
| PubChem CID | 145097857 |
| Molecular Formula | C31H55NO |
| Molecular Weight | 457.79 g/mol |
| Exact Mass | 457.43 |
| IUPAC Name | molecular hydrogen;(1R,4R,5R,10S,13R,19R)-N,4,5,9,9,13,20,20-octamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-amine |
| SMILES | CN[C@H]1CC[C@@]2(C)C(CC[C@]3(C)C2CCC2C4[C@H]5OC[C@@]4(CCC5(C)C)CC[C@]23C)C1(C)C.[H][H] |
| InChI | InChI=1S/C31H53NO.H2/c1-26(2)15-17-31-18-16-29(6)20(24(31)25(26)33-19-31)9-10-22-28(5)13-12-23(32-8)27(3,4)21(28)11-14-30(22,29)7;/h20-25,32H,9-19H2,1-8H3;1H/t20?,21?,22?,23-,24?,25+,28-,29+,30+,31+;/m0./s1 |
| InChIKey | RSPLZKXYKPJDND-LPLLLBAGSA-N |
| XLogP | 7.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.79 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |