C30H49BrO2 — CID 124865369
(1S,4R,5R,8R,10R,11S,13S,14R,17R,18S,19R)-10-bromo-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-11-ol (PubChem CID 124865369) has the molecular formula C30H49BrO2 and a molecular weight of 521.62 g/mol. Its IUPAC name is (1S,4R,5R,8R,10R,11S,13S,14R,17R,18S,19R)-10-bromo-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-11-ol.
| Compound Name | (1S,4R,5R,8R,10R,11S,13S,14R,17R,18S,19R)-10-bromo-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-11-ol |
|---|---|
| PubChem CID | 124865369 |
| Molecular Formula | C30H49BrO2 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | (1S,4R,5R,8R,10R,11S,13S,14R,17R,18S,19R)-10-bromo-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-11-ol |
| SMILES | CC1(C)CC[C@@]23CC[C@]4(C)[C@H](CC[C@@H]5[C@]6(C)C[C@H](O)[C@H](Br)C(C)(C)[C@@H]6CC[C@]54C)[C@@H]2[C@H]1OC3 |
| InChI | InChI=1S/C30H49BrO2/c1-25(2)12-14-30-15-13-28(6)18(22(30)24(25)33-17-30)8-9-21-27(5)16-19(32)23(31)26(3,4)20(27)10-11-29(21,28)7/h18-24,32H,8-17H2,1-7H3/t18-,19+,20+,21-,22-,23+,24-,27-,28-,29-,30+/m1/s1 |
| InChIKey | KJMGDBGFBNCRQT-LEVNDHNQSA-N |
| XLogP | 7.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|