C34H55NO5 — CID 25132412
4-[(10-hydroxy-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-11-yl)amino]-4-oxobutanoic acid (PubChem CID 25132412) has the molecular formula C34H55NO5 and a molecular weight of 557.82 g/mol. Its IUPAC name is 4-[(10-hydroxy-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-11-yl)amino]-4-oxobutanoic acid.
| Compound Name | 4-[(10-hydroxy-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-11-yl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 25132412 |
| Molecular Formula | C34H55NO5 |
| Molecular Weight | 557.82 g/mol |
| Exact Mass | 557.41 |
| IUPAC Name | 4-[(10-hydroxy-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-11-yl)amino]-4-oxobutanoic acid |
| SMILES | CC1(C)CCC23CCC4(C)C(CCC5C6(C)CC(NC(=O)CCC(=O)O)C(O)C(C)(C)C6CCC54C)C2C1OC3 |
| InChI | InChI=1S/C34H55NO5/c1-29(2)14-16-34-17-15-32(6)20(26(34)28(29)40-19-34)8-9-23-31(5)18-21(35-24(36)10-11-25(37)38)27(39)30(3,4)22(31)12-13-33(23,32)7/h20-23,26-28,39H,8-19H2,1-7H3,(H,35,36)(H,37,38) |
| InChIKey | QSEBOSITMUOANT-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.82 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |