C29H41BN2O6 — CID 145098126
ethane;methyl 2-[6-[(2-methylpropan-2-yl)oxycarbonyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3,4-dihydro-1H-isoquinoline-8-carboxylate (PubChem CID 145098126) has the molecular formula C29H41BN2O6 and a molecular weight of 524.47 g/mol. Its IUPAC name is ethane;methyl 2-[6-[(2-methylpropan-2-yl)oxycarbonyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3,4-dihydro-1H-isoquinoline-8-carboxylate.
| Compound Name | ethane;methyl 2-[6-[(2-methylpropan-2-yl)oxycarbonyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3,4-dihydro-1H-isoquinoline-8-carboxylate |
|---|---|
| PubChem CID | 145098126 |
| Molecular Formula | C29H41BN2O6 |
| Molecular Weight | 524.47 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | ethane;methyl 2-[6-[(2-methylpropan-2-yl)oxycarbonyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]-3,4-dihydro-1H-isoquinoline-8-carboxylate |
| SMILES | CC.COC(=O)c1cccc2c1CN(c1ccc(B3OC(C)(C)C(C)(C)O3)c(C(=O)OC(C)(C)C)n1)CC2 |
| InChI | InChI=1S/C27H35BN2O6.C2H6/c1-25(2,3)34-24(32)22-20(28-35-26(4,5)27(6,7)36-28)12-13-21(29-22)30-15-14-17-10-9-11-18(19(17)16-30)23(31)33-8;1-2/h9-13H,14-16H2,1-8H3;1-2H3 |
| InChIKey | DXLXJXLZLCNKDJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|