C34H39BN4O5 — CID 170529718
tert-butyl 6-[8-(3H-indol-2-ylcarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate (PubChem CID 170529718) has the molecular formula C34H39BN4O5 and a molecular weight of 594.52 g/mol. Its IUPAC name is tert-butyl 6-[8-(3H-indol-2-ylcarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate.
| Compound Name | tert-butyl 6-[8-(3H-indol-2-ylcarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 170529718 |
| Molecular Formula | C34H39BN4O5 |
| Molecular Weight | 594.52 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | tert-butyl 6-[8-(3H-indol-2-ylcarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1nc(N2CCc3cccc(C(=O)NC4=Nc5ccccc5C4)c3C2)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C34H39BN4O5/c1-32(2,3)42-31(41)29-25(35-43-33(4,5)34(6,7)44-35)15-16-28(38-29)39-18-17-21-12-10-13-23(24(21)20-39)30(40)37-27-19-22-11-8-9-14-26(22)36-27/h8-16H,17-20H2,1-7H3,(H,36,37,40) |
| InChIKey | HYCLAJOXALVLSB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 102.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|