About ethane;7-fluoro-1-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine
ethane;7-fluoro-1-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine (PubChem CID 145098152) has the molecular formula C10H15F4N3
and a molecular weight of 253.24 g/mol. Its IUPAC name is ethane;7-fluoro-1-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | ethane;7-fluoro-1-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine |
| PubChem CID | 145098152 |
| Molecular Formula | C10H15F4N3 |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | ethane;7-fluoro-1-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine |
| SMILES | CC.Cc1nc(C(F)(F)F)n2c1CN(F)CC2 |
| InChI | InChI=1S/C8H9F4N3.C2H6/c1-5-6-4-14(12)2-3-15(6)7(13-5)8(9,10)11;1-2/h2-4H2,1H3;1-2H3 |
| InChIKey | CZSIFEWKQULBBO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze ethane;7-fluoro-1-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-fluoro-1-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine?
The IUPAC name of ethane;7-fluoro-1-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine (CID 145098152) is ethane;7-fluoro-1-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine.
What is the SMILES notation for ethane;7-fluoro-1-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine?
The canonical SMILES for ethane;7-fluoro-1-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine is CC.Cc1nc(C(F)(F)F)n2c1CN(F)CC2.
What is the InChIKey of ethane;7-fluoro-1-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine?
The InChIKey is CZSIFEWKQULBBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F4N3.C2H6/c1-5-6-4-14(12)2-3-15(6)7(13-5)8(9,10)11;1-2/h2-4H2,1H3;1-2H3.
What are the key properties of ethane;7-fluoro-1-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine?
ethane;7-fluoro-1-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine has a molecular weight of 253.24 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-fluoro-1-methyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine is sourced from PubChem (CID 145098152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).