C27H45N3 — CID 145098743
4-(butylaminomethyl)-N-ethyl-3-methyl-N-propylaniline;(4-ethyl-2-methylphenyl)methanamine (PubChem CID 145098743) has the molecular formula C27H45N3 and a molecular weight of 411.68 g/mol. Its IUPAC name is 4-(butylaminomethyl)-N-ethyl-3-methyl-N-propylaniline;(4-ethyl-2-methylphenyl)methanamine.
| Compound Name | 4-(butylaminomethyl)-N-ethyl-3-methyl-N-propylaniline;(4-ethyl-2-methylphenyl)methanamine |
|---|---|
| PubChem CID | 145098743 |
| Molecular Formula | C27H45N3 |
| Molecular Weight | 411.68 g/mol |
| Exact Mass | 411.36 |
| IUPAC Name | 4-(butylaminomethyl)-N-ethyl-3-methyl-N-propylaniline;(4-ethyl-2-methylphenyl)methanamine |
| SMILES | CCCCNCc1ccc(N(CC)CCC)cc1C.CCc1ccc(CN)c(C)c1 |
| InChI | InChI=1S/C17H30N2.C10H15N/c1-5-8-11-18-14-16-9-10-17(13-15(16)4)19(7-3)12-6-2;1-3-9-4-5-10(7-11)8(2)6-9/h9-10,13,18H,5-8,11-12,14H2,1-4H3;4-6H,3,7,11H2,1-2H3 |
| InChIKey | FJQHVZQFBUFPRJ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.68 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|