C35H33F2N3O4 — CID 145099273
4-tert-butyl-N-[1-[4-[5-[4-(3,4-difluorophenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]-3-oxopropan-2-yl]benzamide;methanol (PubChem CID 145099273) has the molecular formula C35H33F2N3O4 and a molecular weight of 597.66 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-[4-[5-[4-(3,4-difluorophenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]-3-oxopropan-2-yl]benzamide;methanol.
| Compound Name | 4-tert-butyl-N-[1-[4-[5-[4-(3,4-difluorophenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]-3-oxopropan-2-yl]benzamide;methanol |
|---|---|
| PubChem CID | 145099273 |
| Molecular Formula | C35H33F2N3O4 |
| Molecular Weight | 597.66 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | 4-tert-butyl-N-[1-[4-[5-[4-(3,4-difluorophenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]-3-oxopropan-2-yl]benzamide;methanol |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(C=O)Cc2ccc(-c3noc(-c4ccc(-c5ccc(F)c(F)c5)cc4)n3)cc2)cc1.CO |
| InChI | InChI=1S/C34H29F2N3O3.CH4O/c1-34(2,3)27-15-12-24(13-16-27)32(41)37-28(20-40)18-21-4-6-23(7-5-21)31-38-33(42-39-31)25-10-8-22(9-11-25)26-14-17-29(35)30(36)19-26;1-2/h4-17,19-20,28H,18H2,1-3H3,(H,37,41);2H,1H3 |
| InChIKey | DNCFIZOFGCVFNJ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.66 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|