C33H34N4O2 — CID 155130859
4-tert-butyl-N-[1-oxo-3-[4-[5-(1,2,3,4-tetrahydroquinolin-6-yl)pyrimidin-2-yl]phenyl]propan-2-yl]benzamide (PubChem CID 155130859) has the molecular formula C33H34N4O2 and a molecular weight of 518.66 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-oxo-3-[4-[5-(1,2,3,4-tetrahydroquinolin-6-yl)pyrimidin-2-yl]phenyl]propan-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[1-oxo-3-[4-[5-(1,2,3,4-tetrahydroquinolin-6-yl)pyrimidin-2-yl]phenyl]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 155130859 |
| Molecular Formula | C33H34N4O2 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 4-tert-butyl-N-[1-oxo-3-[4-[5-(1,2,3,4-tetrahydroquinolin-6-yl)pyrimidin-2-yl]phenyl]propan-2-yl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(C=O)Cc2ccc(-c3ncc(-c4ccc5c(c4)CCCN5)cn3)cc2)cc1 |
| InChI | InChI=1S/C33H34N4O2/c1-33(2,3)28-13-10-24(11-14-28)32(39)37-29(21-38)17-22-6-8-23(9-7-22)31-35-19-27(20-36-31)25-12-15-30-26(18-25)5-4-16-34-30/h6-15,18-21,29,34H,4-5,16-17H2,1-3H3,(H,37,39) |
| InChIKey | OFOMUJIDEYLNEE-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|