C17H24ClN5O2 — CID 145100338
2-[6-(6-amino-3-pyridinyl)-2-morpholin-4-ylpyrimidin-4-yl]propan-2-ol;chloromethane (PubChem CID 145100338) has the molecular formula C17H24ClN5O2 and a molecular weight of 365.87 g/mol. Its IUPAC name is 2-[6-(6-amino-3-pyridinyl)-2-morpholin-4-ylpyrimidin-4-yl]propan-2-ol;chloromethane.
| Compound Name | 2-[6-(6-amino-3-pyridinyl)-2-morpholin-4-ylpyrimidin-4-yl]propan-2-ol;chloromethane |
|---|---|
| PubChem CID | 145100338 |
| Molecular Formula | C17H24ClN5O2 |
| Molecular Weight | 365.87 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 2-[6-(6-amino-3-pyridinyl)-2-morpholin-4-ylpyrimidin-4-yl]propan-2-ol;chloromethane |
| SMILES | CC(C)(O)c1cc(-c2ccc(N)nc2)nc(N2CCOCC2)n1.CCl |
| InChI | InChI=1S/C16H21N5O2.CH3Cl/c1-16(2,22)13-9-12(11-3-4-14(17)18-10-11)19-15(20-13)21-5-7-23-8-6-21;1-2/h3-4,9-10,22H,5-8H2,1-2H3,(H2,17,18);1H3 |
| InChIKey | WAMDJIDXCHEYQM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.87 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|