C14H11NS — CID 14510107
2-phenyl-4H-1,3-benzothiazine (PubChem CID 14510107) has the molecular formula C14H11NS and a molecular weight of 225.32 g/mol. Its IUPAC name is 2-phenyl-4H-1,3-benzothiazine.
| Compound Name | 2-phenyl-4H-1,3-benzothiazine |
|---|---|
| PubChem CID | 14510107 |
| Molecular Formula | C14H11NS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 2-phenyl-4H-1,3-benzothiazine |
| SMILES | c1ccc(C2=NCc3ccccc3S2)cc1 |
| InChI | InChI=1S/C14H11NS/c1-2-6-11(7-3-1)14-15-10-12-8-4-5-9-13(12)16-14/h1-9H,10H2 |
| InChIKey | LAXBKNIKCYQQRH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |