C8H7NS — CID 54177456
4H-1,3-benzothiazine (PubChem CID 54177456) has the molecular formula C8H7NS and a molecular weight of 149.22 g/mol. Its IUPAC name is 4H-1,3-benzothiazine.
| Compound Name | 4H-1,3-benzothiazine |
|---|---|
| PubChem CID | 54177456 |
| Molecular Formula | C8H7NS |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.03 |
| IUPAC Name | 4H-1,3-benzothiazine |
| SMILES | C1=NCc2ccccc2S1 |
| InChI | InChI=1S/C8H7NS/c1-2-4-8-7(3-1)5-9-6-10-8/h1-4,6H,5H2 |
| InChIKey | OZKJZYPVNPFPSU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |